C14H19BrN2O2S — CID 120707691
N-(8-azabicyclo[3.2.1]octan-3-yl)-4-bromo-2-methylbenzenesulfonamide (PubChem CID 120707691) has the molecular formula C14H19BrN2O2S and a molecular weight of 359.29 g/mol. Its IUPAC name is N-(8-azabicyclo[3.2.1]octan-3-yl)-4-bromo-2-methylbenzenesulfonamide.
| Compound Name | N-(8-azabicyclo[3.2.1]octan-3-yl)-4-bromo-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 120707691 |
| Molecular Formula | C14H19BrN2O2S |
| Molecular Weight | 359.29 g/mol |
| Exact Mass | 358.04 |
| IUPAC Name | N-(8-azabicyclo[3.2.1]octan-3-yl)-4-bromo-2-methylbenzenesulfonamide |
| SMILES | Cc1cc(Br)ccc1S(=O)(=O)NC1CC2CCC(C1)N2 |
| InChI | InChI=1S/C14H19BrN2O2S/c1-9-6-10(15)2-5-14(9)20(18,19)17-13-7-11-3-4-12(8-13)16-11/h2,5-6,11-13,16-17H,3-4,7-8H2,1H3 |
| InChIKey | ZGOAGCOGBICZMQ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.29 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |