C13H16F4N2O2S — CID 120710188
N-[1-(aminomethyl)cyclopentyl]-3-fluoro-4-(trifluoromethyl)benzenesulfonamide (PubChem CID 120710188) has the molecular formula C13H16F4N2O2S and a molecular weight of 340.34 g/mol. Its IUPAC name is N-[1-(aminomethyl)cyclopentyl]-3-fluoro-4-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-[1-(aminomethyl)cyclopentyl]-3-fluoro-4-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 120710188 |
| Molecular Formula | C13H16F4N2O2S |
| Molecular Weight | 340.34 g/mol |
| Exact Mass | 340.09 |
| IUPAC Name | N-[1-(aminomethyl)cyclopentyl]-3-fluoro-4-(trifluoromethyl)benzenesulfonamide |
| SMILES | NCC1(NS(=O)(=O)c2ccc(C(F)(F)F)c(F)c2)CCCC1 |
| InChI | InChI=1S/C13H16F4N2O2S/c14-11-7-9(3-4-10(11)13(15,16)17)22(20,21)19-12(8-18)5-1-2-6-12/h3-4,7,19H,1-2,5-6,8,18H2 |
| InChIKey | DHGQLMZVRGGVJQ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.34 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |