About 8-(3,9-diazabicyclo[4.2.1]nonan-3-ylsulfonyl)-5-nitroquinoline
8-(3,9-diazabicyclo[4.2.1]nonan-3-ylsulfonyl)-5-nitroquinoline (PubChem CID 120711745) has the molecular formula C16H18N4O4S
and a molecular weight of 362.41 g/mol. Its IUPAC name is 8-(3,9-diazabicyclo[4.2.1]nonan-3-ylsulfonyl)-5-nitroquinoline.
Molecular Properties
| Compound Name | 8-(3,9-diazabicyclo[4.2.1]nonan-3-ylsulfonyl)-5-nitroquinoline |
| PubChem CID | 120711745 |
| Molecular Formula | C16H18N4O4S |
| Molecular Weight | 362.41 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | 8-(3,9-diazabicyclo[4.2.1]nonan-3-ylsulfonyl)-5-nitroquinoline |
| SMILES | O=[N+]([O-])c1ccc(S(=O)(=O)N2CCC3CCC(C2)N3)c2ncccc12 |
| InChI | InChI=1S/C16H18N4O4S/c21-20(22)14-5-6-15(16-13(14)2-1-8-17-16)25(23,24)19-9-7-11-3-4-12(10-19)18-11/h1-2,5-6,8,11-12,18H,3-4,7,9-10H2 |
| InChIKey | OXCDRJLKTLRSMC-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 105.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.41 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 8-(3,9-diazabicyclo[4.2.1]nonan-3-ylsulfonyl)-5-nitroquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(3,9-diazabicyclo[4.2.1]nonan-3-ylsulfonyl)-5-nitroquinoline?
The IUPAC name of 8-(3,9-diazabicyclo[4.2.1]nonan-3-ylsulfonyl)-5-nitroquinoline (CID 120711745) is 8-(3,9-diazabicyclo[4.2.1]nonan-3-ylsulfonyl)-5-nitroquinoline.
What is the SMILES notation for 8-(3,9-diazabicyclo[4.2.1]nonan-3-ylsulfonyl)-5-nitroquinoline?
The canonical SMILES for 8-(3,9-diazabicyclo[4.2.1]nonan-3-ylsulfonyl)-5-nitroquinoline is O=[N+]([O-])c1ccc(S(=O)(=O)N2CCC3CCC(C2)N3)c2ncccc12.
What is the InChIKey of 8-(3,9-diazabicyclo[4.2.1]nonan-3-ylsulfonyl)-5-nitroquinoline?
The InChIKey is OXCDRJLKTLRSMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N4O4S/c21-20(22)14-5-6-15(16-13(14)2-1-8-17-16)25(23,24)19-9-7-11-3-4-12(10-19)18-11/h1-2,5-6,8,11-12,18H,3-4,7,9-10H2.
What are the key properties of 8-(3,9-diazabicyclo[4.2.1]nonan-3-ylsulfonyl)-5-nitroquinoline?
8-(3,9-diazabicyclo[4.2.1]nonan-3-ylsulfonyl)-5-nitroquinoline has a molecular weight of 362.41 g/mol, XLogP of 1.66, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(3,9-diazabicyclo[4.2.1]nonan-3-ylsulfonyl)-5-nitroquinoline is sourced from PubChem (CID 120711745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).