C15H23ClN2O5S — CID 120712112
methyl 2-methoxy-4-[2-(methylaminomethyl)pyrrolidin-1-yl]sulfonylbenzoate;hydrochloride (PubChem CID 120712112) has the molecular formula C15H23ClN2O5S and a molecular weight of 378.88 g/mol. Its IUPAC name is methyl 2-methoxy-4-[2-(methylaminomethyl)pyrrolidin-1-yl]sulfonylbenzoate;hydrochloride.
| Compound Name | methyl 2-methoxy-4-[2-(methylaminomethyl)pyrrolidin-1-yl]sulfonylbenzoate;hydrochloride |
|---|---|
| PubChem CID | 120712112 |
| Molecular Formula | C15H23ClN2O5S |
| Molecular Weight | 378.88 g/mol |
| Exact Mass | 378.10 |
| IUPAC Name | methyl 2-methoxy-4-[2-(methylaminomethyl)pyrrolidin-1-yl]sulfonylbenzoate;hydrochloride |
| SMILES | CNCC1CCCN1S(=O)(=O)c1ccc(C(=O)OC)c(OC)c1.Cl |
| InChI | InChI=1S/C15H22N2O5S.ClH/c1-16-10-11-5-4-8-17(11)23(19,20)12-6-7-13(15(18)22-3)14(9-12)21-2;/h6-7,9,11,16H,4-5,8,10H2,1-3H3;1H |
| InChIKey | GDDMGVNHCUTURA-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.88 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |