About N-(3-amino-2,2-dimethylpropyl)-1-(2,2-difluoroethyl)-N-methylpyrazole-4-sulfonamide
N-(3-amino-2,2-dimethylpropyl)-1-(2,2-difluoroethyl)-N-methylpyrazole-4-sulfonamide (PubChem CID 120712272) has the molecular formula C11H20F2N4O2S
and a molecular weight of 310.37 g/mol. Its IUPAC name is N-(3-amino-2,2-dimethylpropyl)-1-(2,2-difluoroethyl)-N-methylpyrazole-4-sulfonamide.
Molecular Properties
| Compound Name | N-(3-amino-2,2-dimethylpropyl)-1-(2,2-difluoroethyl)-N-methylpyrazole-4-sulfonamide |
| PubChem CID | 120712272 |
| Molecular Formula | C11H20F2N4O2S |
| Molecular Weight | 310.37 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | N-(3-amino-2,2-dimethylpropyl)-1-(2,2-difluoroethyl)-N-methylpyrazole-4-sulfonamide |
| SMILES | CN(CC(C)(C)CN)S(=O)(=O)c1cnn(CC(F)F)c1 |
| InChI | InChI=1S/C11H20F2N4O2S/c1-11(2,7-14)8-16(3)20(18,19)9-4-15-17(5-9)6-10(12)13/h4-5,10H,6-8,14H2,1-3H3 |
| InChIKey | BXDMXNNVHHBTAI-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 81.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.37 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(3-amino-2,2-dimethylpropyl)-1-(2,2-difluoroethyl)-N-methylpyrazole-4-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-amino-2,2-dimethylpropyl)-1-(2,2-difluoroethyl)-N-methylpyrazole-4-sulfonamide?
The IUPAC name of N-(3-amino-2,2-dimethylpropyl)-1-(2,2-difluoroethyl)-N-methylpyrazole-4-sulfonamide (CID 120712272) is N-(3-amino-2,2-dimethylpropyl)-1-(2,2-difluoroethyl)-N-methylpyrazole-4-sulfonamide.
What is the SMILES notation for N-(3-amino-2,2-dimethylpropyl)-1-(2,2-difluoroethyl)-N-methylpyrazole-4-sulfonamide?
The canonical SMILES for N-(3-amino-2,2-dimethylpropyl)-1-(2,2-difluoroethyl)-N-methylpyrazole-4-sulfonamide is CN(CC(C)(C)CN)S(=O)(=O)c1cnn(CC(F)F)c1.
What is the InChIKey of N-(3-amino-2,2-dimethylpropyl)-1-(2,2-difluoroethyl)-N-methylpyrazole-4-sulfonamide?
The InChIKey is BXDMXNNVHHBTAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20F2N4O2S/c1-11(2,7-14)8-16(3)20(18,19)9-4-15-17(5-9)6-10(12)13/h4-5,10H,6-8,14H2,1-3H3.
What are the key properties of N-(3-amino-2,2-dimethylpropyl)-1-(2,2-difluoroethyl)-N-methylpyrazole-4-sulfonamide?
N-(3-amino-2,2-dimethylpropyl)-1-(2,2-difluoroethyl)-N-methylpyrazole-4-sulfonamide has a molecular weight of 310.37 g/mol, XLogP of 0.75, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-amino-2,2-dimethylpropyl)-1-(2,2-difluoroethyl)-N-methylpyrazole-4-sulfonamide is sourced from PubChem (CID 120712272), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).