C14H23N3O4S — CID 120712282
N-(3-amino-2,2-dimethylpropyl)-N,3,6-trimethyl-2-nitrobenzenesulfonamide (PubChem CID 120712282) has the molecular formula C14H23N3O4S and a molecular weight of 329.42 g/mol. Its IUPAC name is N-(3-amino-2,2-dimethylpropyl)-N,3,6-trimethyl-2-nitrobenzenesulfonamide.
| Compound Name | N-(3-amino-2,2-dimethylpropyl)-N,3,6-trimethyl-2-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 120712282 |
| Molecular Formula | C14H23N3O4S |
| Molecular Weight | 329.42 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | N-(3-amino-2,2-dimethylpropyl)-N,3,6-trimethyl-2-nitrobenzenesulfonamide |
| SMILES | Cc1ccc(C)c(S(=O)(=O)N(C)CC(C)(C)CN)c1[N+](=O)[O-] |
| InChI | InChI=1S/C14H23N3O4S/c1-10-6-7-11(2)13(12(10)17(18)19)22(20,21)16(5)9-14(3,4)8-15/h6-7H,8-9,15H2,1-5H3 |
| InChIKey | GOAQBUNCALICMQ-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 106.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.42 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|