C22H36O — CID 12071383
(3S,5R,8R,9R,10R,13R,14R)-4,4,8,10,14-pentamethyl-2,3,5,6,7,9,11,12,13,15-decahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 12071383) has the molecular formula C22H36O and a molecular weight of 316.53 g/mol. Its IUPAC name is (3S,5R,8R,9R,10R,13R,14R)-4,4,8,10,14-pentamethyl-2,3,5,6,7,9,11,12,13,15-decahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (3S,5R,8R,9R,10R,13R,14R)-4,4,8,10,14-pentamethyl-2,3,5,6,7,9,11,12,13,15-decahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 12071383 |
| Molecular Formula | C22H36O |
| Molecular Weight | 316.53 g/mol |
| Exact Mass | 316.28 |
| IUPAC Name | (3S,5R,8R,9R,10R,13R,14R)-4,4,8,10,14-pentamethyl-2,3,5,6,7,9,11,12,13,15-decahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | CC1(C)[C@@H](O)CC[C@]2(C)[C@H]3CC[C@@H]4C=CC[C@@]4(C)[C@]3(C)CC[C@@H]12 |
| InChI | InChI=1S/C22H36O/c1-19(2)16-10-14-22(5)17(20(16,3)13-11-18(19)23)9-8-15-7-6-12-21(15,22)4/h6-7,15-18,23H,8-14H2,1-5H3/t15-,16-,17+,18-,20-,21+,22+/m0/s1 |
| InChIKey | UFUNZTHIOJRTHF-DRAFNHJNSA-N |
| XLogP | 5.58 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.53 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|