C11H15F3N4O2S — CID 120714040
(3aR,6aS)-5-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]sulfonyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole (PubChem CID 120714040) has the molecular formula C11H15F3N4O2S and a molecular weight of 324.33 g/mol. Its IUPAC name is (3aR,6aS)-5-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]sulfonyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole.
| Compound Name | (3aR,6aS)-5-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]sulfonyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole |
|---|---|
| PubChem CID | 120714040 |
| Molecular Formula | C11H15F3N4O2S |
| Molecular Weight | 324.33 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | (3aR,6aS)-5-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]sulfonyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole |
| SMILES | O=S(=O)(c1cnn(CC(F)(F)F)c1)N1C[C@H]2CNC[C@H]2C1 |
| InChI | InChI=1S/C11H15F3N4O2S/c12-11(13,14)7-17-6-10(3-16-17)21(19,20)18-4-8-1-15-2-9(8)5-18/h3,6,8-9,15H,1-2,4-5,7H2/t8-,9+ |
| InChIKey | YUHOOFDSYKLFEY-DTORHVGOSA-N |
| XLogP | 0.29 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.33 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |