C23H25F3O3 — CID 12071759
2,2,8,8-tetramethyl-6-[3-(trifluoromethyl)phenyl]-3,4,6,7-tetrahydropyrano[3,2-g]chromen-4-ol (PubChem CID 12071759) has the molecular formula C23H25F3O3 and a molecular weight of 406.44 g/mol. Its IUPAC name is 2,2,8,8-tetramethyl-6-[3-(trifluoromethyl)phenyl]-3,4,6,7-tetrahydropyrano[3,2-g]chromen-4-ol.
| Compound Name | 2,2,8,8-tetramethyl-6-[3-(trifluoromethyl)phenyl]-3,4,6,7-tetrahydropyrano[3,2-g]chromen-4-ol |
|---|---|
| PubChem CID | 12071759 |
| Molecular Formula | C23H25F3O3 |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.18 |
| IUPAC Name | 2,2,8,8-tetramethyl-6-[3-(trifluoromethyl)phenyl]-3,4,6,7-tetrahydropyrano[3,2-g]chromen-4-ol |
| SMILES | CC1(C)CC(O)c2cc3c(cc2O1)OC(C)(C)CC3c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C23H25F3O3/c1-21(2)11-17(13-6-5-7-14(8-13)23(24,25)26)15-9-16-18(27)12-22(3,4)29-20(16)10-19(15)28-21/h5-10,17-18,27H,11-12H2,1-4H3 |
| InChIKey | HSSZKCCQIOZRSD-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |