C17H29ClN2O2S — CID 120720830
4-butan-2-yl-N-[(3-methylpiperidin-3-yl)methyl]benzenesulfonamide;hydrochloride (PubChem CID 120720830) has the molecular formula C17H29ClN2O2S and a molecular weight of 360.95 g/mol. Its IUPAC name is 4-butan-2-yl-N-[(3-methylpiperidin-3-yl)methyl]benzenesulfonamide;hydrochloride.
| Compound Name | 4-butan-2-yl-N-[(3-methylpiperidin-3-yl)methyl]benzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120720830 |
| Molecular Formula | C17H29ClN2O2S |
| Molecular Weight | 360.95 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | 4-butan-2-yl-N-[(3-methylpiperidin-3-yl)methyl]benzenesulfonamide;hydrochloride |
| SMILES | CCC(C)c1ccc(S(=O)(=O)NCC2(C)CCCNC2)cc1.Cl |
| InChI | InChI=1S/C17H28N2O2S.ClH/c1-4-14(2)15-6-8-16(9-7-15)22(20,21)19-13-17(3)10-5-11-18-12-17;/h6-9,14,18-19H,4-5,10-13H2,1-3H3;1H |
| InChIKey | HIVLNUXMXINLCH-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.95 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |