C12H19ClN2O3S — CID 120720923
2-methoxy-N-(pyrrolidin-3-ylmethyl)benzenesulfonamide;hydrochloride (PubChem CID 120720923) has the molecular formula C12H19ClN2O3S and a molecular weight of 306.81 g/mol. Its IUPAC name is 2-methoxy-N-(pyrrolidin-3-ylmethyl)benzenesulfonamide;hydrochloride.
| Compound Name | 2-methoxy-N-(pyrrolidin-3-ylmethyl)benzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120720923 |
| Molecular Formula | C12H19ClN2O3S |
| Molecular Weight | 306.81 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | 2-methoxy-N-(pyrrolidin-3-ylmethyl)benzenesulfonamide;hydrochloride |
| SMILES | COc1ccccc1S(=O)(=O)NCC1CCNC1.Cl |
| InChI | InChI=1S/C12H18N2O3S.ClH/c1-17-11-4-2-3-5-12(11)18(15,16)14-9-10-6-7-13-8-10;/h2-5,10,13-14H,6-9H2,1H3;1H |
| InChIKey | BPRZYXJXNIFFAT-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.81 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |