C12H24N2O2S — CID 120721535
2-methyl-N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)pentane-1-sulfonamide (PubChem CID 120721535) has the molecular formula C12H24N2O2S and a molecular weight of 260.40 g/mol. Its IUPAC name is 2-methyl-N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)pentane-1-sulfonamide.
| Compound Name | 2-methyl-N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)pentane-1-sulfonamide |
|---|---|
| PubChem CID | 120721535 |
| Molecular Formula | C12H24N2O2S |
| Molecular Weight | 260.40 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | 2-methyl-N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)pentane-1-sulfonamide |
| SMILES | CCCC(C)CS(=O)(=O)NCC1=CCNCC1 |
| InChI | InChI=1S/C12H24N2O2S/c1-3-4-11(2)10-17(15,16)14-9-12-5-7-13-8-6-12/h5,11,13-14H,3-4,6-10H2,1-2H3 |
| InChIKey | AOTXDPXFLNPWSP-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.40 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|