C17H20ClFN2O2S — CID 120722112
N-(6-amino-1,2,3,4-tetrahydronaphthalen-1-yl)-1-(4-fluorophenyl)methanesulfonamide;hydrochloride (PubChem CID 120722112) has the molecular formula C17H20ClFN2O2S and a molecular weight of 370.88 g/mol. Its IUPAC name is N-(6-amino-1,2,3,4-tetrahydronaphthalen-1-yl)-1-(4-fluorophenyl)methanesulfonamide;hydrochloride.
| Compound Name | N-(6-amino-1,2,3,4-tetrahydronaphthalen-1-yl)-1-(4-fluorophenyl)methanesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120722112 |
| Molecular Formula | C17H20ClFN2O2S |
| Molecular Weight | 370.88 g/mol |
| Exact Mass | 370.09 |
| IUPAC Name | N-(6-amino-1,2,3,4-tetrahydronaphthalen-1-yl)-1-(4-fluorophenyl)methanesulfonamide;hydrochloride |
| SMILES | Cl.Nc1ccc2c(c1)CCCC2NS(=O)(=O)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C17H19FN2O2S.ClH/c18-14-6-4-12(5-7-14)11-23(21,22)20-17-3-1-2-13-10-15(19)8-9-16(13)17;/h4-10,17,20H,1-3,11,19H2;1H |
| InChIKey | WTIMUPPFELHRMC-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.88 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|