C14H15Cl3N2O2S2 — CID 120722180
N-(6-amino-1,2,3,4-tetrahydronaphthalen-1-yl)-2,5-dichlorothiophene-3-sulfonamide;hydrochloride (PubChem CID 120722180) has the molecular formula C14H15Cl3N2O2S2 and a molecular weight of 413.78 g/mol. Its IUPAC name is N-(6-amino-1,2,3,4-tetrahydronaphthalen-1-yl)-2,5-dichlorothiophene-3-sulfonamide;hydrochloride.
| Compound Name | N-(6-amino-1,2,3,4-tetrahydronaphthalen-1-yl)-2,5-dichlorothiophene-3-sulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120722180 |
| Molecular Formula | C14H15Cl3N2O2S2 |
| Molecular Weight | 413.78 g/mol |
| Exact Mass | 411.96 |
| IUPAC Name | N-(6-amino-1,2,3,4-tetrahydronaphthalen-1-yl)-2,5-dichlorothiophene-3-sulfonamide;hydrochloride |
| SMILES | Cl.Nc1ccc2c(c1)CCCC2NS(=O)(=O)c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C14H14Cl2N2O2S2.ClH/c15-13-7-12(14(16)21-13)22(19,20)18-11-3-1-2-8-6-9(17)4-5-10(8)11;/h4-7,11,18H,1-3,17H2;1H |
| InChIKey | PDHMUVPPGYGSAO-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.78 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|