C12H16F3N3O2S — CID 120722916
N-(4-methylpiperidin-3-yl)-6-(trifluoromethyl)pyridine-3-sulfonamide (PubChem CID 120722916) has the molecular formula C12H16F3N3O2S and a molecular weight of 323.34 g/mol. Its IUPAC name is N-(4-methylpiperidin-3-yl)-6-(trifluoromethyl)pyridine-3-sulfonamide.
| Compound Name | N-(4-methylpiperidin-3-yl)-6-(trifluoromethyl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 120722916 |
| Molecular Formula | C12H16F3N3O2S |
| Molecular Weight | 323.34 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | N-(4-methylpiperidin-3-yl)-6-(trifluoromethyl)pyridine-3-sulfonamide |
| SMILES | CC1CCNCC1NS(=O)(=O)c1ccc(C(F)(F)F)nc1 |
| InChI | InChI=1S/C12H16F3N3O2S/c1-8-4-5-16-7-10(8)18-21(19,20)9-2-3-11(17-6-9)12(13,14)15/h2-3,6,8,10,16,18H,4-5,7H2,1H3 |
| InChIKey | QZGBGUOVWHDBHG-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.34 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |