C14H23ClN2O3S — CID 120722944
3-(methoxymethyl)-N-(4-methylpiperidin-3-yl)benzenesulfonamide;hydrochloride (PubChem CID 120722944) has the molecular formula C14H23ClN2O3S and a molecular weight of 334.87 g/mol. Its IUPAC name is 3-(methoxymethyl)-N-(4-methylpiperidin-3-yl)benzenesulfonamide;hydrochloride.
| Compound Name | 3-(methoxymethyl)-N-(4-methylpiperidin-3-yl)benzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120722944 |
| Molecular Formula | C14H23ClN2O3S |
| Molecular Weight | 334.87 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | 3-(methoxymethyl)-N-(4-methylpiperidin-3-yl)benzenesulfonamide;hydrochloride |
| SMILES | COCc1cccc(S(=O)(=O)NC2CNCCC2C)c1.Cl |
| InChI | InChI=1S/C14H22N2O3S.ClH/c1-11-6-7-15-9-14(11)16-20(17,18)13-5-3-4-12(8-13)10-19-2;/h3-5,8,11,14-16H,6-7,9-10H2,1-2H3;1H |
| InChIKey | VMNFGJUKYDBCQA-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.87 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |