C40H50N2O6 — CID 12072329
trans-(2S,3S)-8,11-dibenzyl-2,3-bis(phenylmethoxymethyl)-1,4-dioxa-8,11-diazacyclotetradecane-6,13-diol (PubChem CID 12072329) has the molecular formula C40H50N2O6 and a molecular weight of 654.85 g/mol. Its IUPAC name is trans-(2S,3S)-8,11-dibenzyl-2,3-bis(phenylmethoxymethyl)-1,4-dioxa-8,11-diazacyclotetradecane-6,13-diol.
| Compound Name | trans-(2S,3S)-8,11-dibenzyl-2,3-bis(phenylmethoxymethyl)-1,4-dioxa-8,11-diazacyclotetradecane-6,13-diol |
|---|---|
| PubChem CID | 12072329 |
| Molecular Formula | C40H50N2O6 |
| Molecular Weight | 654.85 g/mol |
| Exact Mass | 654.37 |
| IUPAC Name | trans-(2S,3S)-8,11-dibenzyl-2,3-bis(phenylmethoxymethyl)-1,4-dioxa-8,11-diazacyclotetradecane-6,13-diol |
| SMILES | OC1CO[C@@H](COCc2ccccc2)[C@H](COCc2ccccc2)OCC(O)CN(Cc2ccccc2)CCN(Cc2ccccc2)C1 |
| InChI | InChI=1S/C40H50N2O6/c43-37-25-41(23-33-13-5-1-6-14-33)21-22-42(24-34-15-7-2-8-16-34)26-38(44)30-48-40(32-46-28-36-19-11-4-12-20-36)39(47-29-37)31-45-27-35-17-9-3-10-18-35/h1-20,37-40,43-44H,21-32H2/t37?,38?,39-,40-/m0/s1 |
| InChIKey | AOEVOLZQMQAAAG-XSCWVFDWSA-N |
| XLogP | 4.93 |
| TPSA | 83.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.85 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |