C24H30O4 — CID 12072336
2,3-bis[2-[(E)-but-2-enoxy]phenyl]butane-2,3-diol (PubChem CID 12072336) has the molecular formula C24H30O4 and a molecular weight of 382.50 g/mol. Its IUPAC name is 2,3-bis[2-[(E)-but-2-enoxy]phenyl]butane-2,3-diol.
| Compound Name | 2,3-bis[2-[(E)-but-2-enoxy]phenyl]butane-2,3-diol |
|---|---|
| PubChem CID | 12072336 |
| Molecular Formula | C24H30O4 |
| Molecular Weight | 382.50 g/mol |
| Exact Mass | 382.21 |
| IUPAC Name | 2,3-bis[2-[(E)-but-2-enoxy]phenyl]butane-2,3-diol |
| SMILES | C/C=C/COc1ccccc1C(C)(O)C(C)(O)c1ccccc1OC/C=C/C |
| InChI | InChI=1S/C24H30O4/c1-5-7-17-27-21-15-11-9-13-19(21)23(3,25)24(4,26)20-14-10-12-16-22(20)28-18-8-6-2/h5-16,25-26H,17-18H2,1-4H3/b7-5+,8-6+ |
| InChIKey | NOOIEPBAHPXKKM-KQQUZDAGSA-N |
| XLogP | 4.71 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.50 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|