C12H15ClFN3O2S — CID 120723667
3-cyano-4-fluoro-N-[(3R)-piperidin-3-yl]benzenesulfonamide;hydrochloride (PubChem CID 120723667) has the molecular formula C12H15ClFN3O2S and a molecular weight of 319.79 g/mol. Its IUPAC name is 3-cyano-4-fluoro-N-[(3R)-piperidin-3-yl]benzenesulfonamide;hydrochloride.
| Compound Name | 3-cyano-4-fluoro-N-[(3R)-piperidin-3-yl]benzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120723667 |
| Molecular Formula | C12H15ClFN3O2S |
| Molecular Weight | 319.79 g/mol |
| Exact Mass | 319.06 |
| IUPAC Name | 3-cyano-4-fluoro-N-[(3R)-piperidin-3-yl]benzenesulfonamide;hydrochloride |
| SMILES | Cl.N#Cc1cc(S(=O)(=O)N[C@@H]2CCCNC2)ccc1F |
| InChI | InChI=1S/C12H14FN3O2S.ClH/c13-12-4-3-11(6-9(12)7-14)19(17,18)16-10-2-1-5-15-8-10;/h3-4,6,10,15-16H,1-2,5,8H2;1H/t10-;/m1./s1 |
| InChIKey | YAISNSSDYYQUIZ-HNCPQSOCSA-N |
| XLogP | 1.15 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.79 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |