About 2-chloro-N-(2,3-dihydro-1H-isoindol-5-ylmethyl)-4-fluoro-5-methylbenzenesulfonamide
2-chloro-N-(2,3-dihydro-1H-isoindol-5-ylmethyl)-4-fluoro-5-methylbenzenesulfonamide (PubChem CID 120723899) has the molecular formula C16H16ClFN2O2S
and a molecular weight of 354.83 g/mol. Its IUPAC name is 2-chloro-N-(2,3-dihydro-1H-isoindol-5-ylmethyl)-4-fluoro-5-methylbenzenesulfonamide.
Molecular Properties
| Compound Name | 2-chloro-N-(2,3-dihydro-1H-isoindol-5-ylmethyl)-4-fluoro-5-methylbenzenesulfonamide |
| PubChem CID | 120723899 |
| Molecular Formula | C16H16ClFN2O2S |
| Molecular Weight | 354.83 g/mol |
| Exact Mass | 354.06 |
| IUPAC Name | 2-chloro-N-(2,3-dihydro-1H-isoindol-5-ylmethyl)-4-fluoro-5-methylbenzenesulfonamide |
| SMILES | Cc1cc(S(=O)(=O)NCc2ccc3c(c2)CNC3)c(Cl)cc1F |
| InChI | InChI=1S/C16H16ClFN2O2S/c1-10-4-16(14(17)6-15(10)18)23(21,22)20-7-11-2-3-12-8-19-9-13(12)5-11/h2-6,19-20H,7-9H2,1H3 |
| InChIKey | AWMPAYPUJAACGQ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.83 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-chloro-N-(2,3-dihydro-1H-isoindol-5-ylmethyl)-4-fluoro-5-methylbenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-N-(2,3-dihydro-1H-isoindol-5-ylmethyl)-4-fluoro-5-methylbenzenesulfonamide?
The IUPAC name of 2-chloro-N-(2,3-dihydro-1H-isoindol-5-ylmethyl)-4-fluoro-5-methylbenzenesulfonamide (CID 120723899) is 2-chloro-N-(2,3-dihydro-1H-isoindol-5-ylmethyl)-4-fluoro-5-methylbenzenesulfonamide.
What is the SMILES notation for 2-chloro-N-(2,3-dihydro-1H-isoindol-5-ylmethyl)-4-fluoro-5-methylbenzenesulfonamide?
The canonical SMILES for 2-chloro-N-(2,3-dihydro-1H-isoindol-5-ylmethyl)-4-fluoro-5-methylbenzenesulfonamide is Cc1cc(S(=O)(=O)NCc2ccc3c(c2)CNC3)c(Cl)cc1F.
What is the InChIKey of 2-chloro-N-(2,3-dihydro-1H-isoindol-5-ylmethyl)-4-fluoro-5-methylbenzenesulfonamide?
The InChIKey is AWMPAYPUJAACGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16ClFN2O2S/c1-10-4-16(14(17)6-15(10)18)23(21,22)20-7-11-2-3-12-8-19-9-13(12)5-11/h2-6,19-20H,7-9H2,1H3.
What are the key properties of 2-chloro-N-(2,3-dihydro-1H-isoindol-5-ylmethyl)-4-fluoro-5-methylbenzenesulfonamide?
2-chloro-N-(2,3-dihydro-1H-isoindol-5-ylmethyl)-4-fluoro-5-methylbenzenesulfonamide has a molecular weight of 354.83 g/mol, XLogP of 2.87, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-N-(2,3-dihydro-1H-isoindol-5-ylmethyl)-4-fluoro-5-methylbenzenesulfonamide is sourced from PubChem (CID 120723899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).