C18H20OS — CID 12072424
(2S)-1-[(E)-1,3-diphenylprop-1-en-2-yl]sulfanylpropan-2-ol (PubChem CID 12072424) has the molecular formula C18H20OS and a molecular weight of 284.42 g/mol. Its IUPAC name is (2S)-1-[(E)-1,3-diphenylprop-1-en-2-yl]sulfanylpropan-2-ol.
| Compound Name | (2S)-1-[(E)-1,3-diphenylprop-1-en-2-yl]sulfanylpropan-2-ol |
|---|---|
| PubChem CID | 12072424 |
| Molecular Formula | C18H20OS |
| Molecular Weight | 284.42 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | (2S)-1-[(E)-1,3-diphenylprop-1-en-2-yl]sulfanylpropan-2-ol |
| SMILES | C[C@H](O)CS/C(=C/c1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C18H20OS/c1-15(19)14-20-18(12-16-8-4-2-5-9-16)13-17-10-6-3-7-11-17/h2-12,15,19H,13-14H2,1H3/b18-12+/t15-/m0/s1 |
| InChIKey | DCGYPZUYJAAARR-BRFSQIRFSA-N |
| XLogP | 4.38 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.42 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |