C16H18ClN3O5S — CID 120724318
N-(2,3-dihydro-1H-isoindol-5-ylmethyl)-2-methoxy-4-nitrobenzenesulfonamide;hydrochloride (PubChem CID 120724318) has the molecular formula C16H18ClN3O5S and a molecular weight of 399.86 g/mol. Its IUPAC name is N-(2,3-dihydro-1H-isoindol-5-ylmethyl)-2-methoxy-4-nitrobenzenesulfonamide;hydrochloride.
| Compound Name | N-(2,3-dihydro-1H-isoindol-5-ylmethyl)-2-methoxy-4-nitrobenzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120724318 |
| Molecular Formula | C16H18ClN3O5S |
| Molecular Weight | 399.86 g/mol |
| Exact Mass | 399.07 |
| IUPAC Name | N-(2,3-dihydro-1H-isoindol-5-ylmethyl)-2-methoxy-4-nitrobenzenesulfonamide;hydrochloride |
| SMILES | COc1cc([N+](=O)[O-])ccc1S(=O)(=O)NCc1ccc2c(c1)CNC2.Cl |
| InChI | InChI=1S/C16H17N3O5S.ClH/c1-24-15-7-14(19(20)21)4-5-16(15)25(22,23)18-8-11-2-3-12-9-17-10-13(12)6-11;/h2-7,17-18H,8-10H2,1H3;1H |
| InChIKey | DFNDCVWARZIZHS-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.86 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|