C17H20F2N2O3S — CID 120724446
N-[4-(3,4-difluorophenyl)piperidin-3-yl]-2,5-dimethylfuran-3-sulfonamide (PubChem CID 120724446) has the molecular formula C17H20F2N2O3S and a molecular weight of 370.42 g/mol. Its IUPAC name is N-[4-(3,4-difluorophenyl)piperidin-3-yl]-2,5-dimethylfuran-3-sulfonamide.
| Compound Name | N-[4-(3,4-difluorophenyl)piperidin-3-yl]-2,5-dimethylfuran-3-sulfonamide |
|---|---|
| PubChem CID | 120724446 |
| Molecular Formula | C17H20F2N2O3S |
| Molecular Weight | 370.42 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | N-[4-(3,4-difluorophenyl)piperidin-3-yl]-2,5-dimethylfuran-3-sulfonamide |
| SMILES | Cc1cc(S(=O)(=O)NC2CNCCC2c2ccc(F)c(F)c2)c(C)o1 |
| InChI | InChI=1S/C17H20F2N2O3S/c1-10-7-17(11(2)24-10)25(22,23)21-16-9-20-6-5-13(16)12-3-4-14(18)15(19)8-12/h3-4,7-8,13,16,20-21H,5-6,9H2,1-2H3 |
| InChIKey | XNTBPWJKBZGYLW-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.42 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |