C13H20N2O5S — CID 120725208
methyl 5-methyl-4-[(3-methylpiperidin-4-yl)sulfamoyl]furan-2-carboxylate (PubChem CID 120725208) has the molecular formula C13H20N2O5S and a molecular weight of 316.38 g/mol. Its IUPAC name is methyl 5-methyl-4-[(3-methylpiperidin-4-yl)sulfamoyl]furan-2-carboxylate.
| Compound Name | methyl 5-methyl-4-[(3-methylpiperidin-4-yl)sulfamoyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 120725208 |
| Molecular Formula | C13H20N2O5S |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | methyl 5-methyl-4-[(3-methylpiperidin-4-yl)sulfamoyl]furan-2-carboxylate |
| SMILES | COC(=O)c1cc(S(=O)(=O)NC2CCNCC2C)c(C)o1 |
| InChI | InChI=1S/C13H20N2O5S/c1-8-7-14-5-4-10(8)15-21(17,18)12-6-11(13(16)19-3)20-9(12)2/h6,8,10,14-15H,4-5,7H2,1-3H3 |
| InChIKey | YZDLBUFZUQPNBI-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |