C13H20FN3O4S2 — CID 120726470
3-fluoro-4-(methanesulfonamido)-N-(2-methylpiperidin-3-yl)benzenesulfonamide (PubChem CID 120726470) has the molecular formula C13H20FN3O4S2 and a molecular weight of 365.45 g/mol. Its IUPAC name is 3-fluoro-4-(methanesulfonamido)-N-(2-methylpiperidin-3-yl)benzenesulfonamide.
| Compound Name | 3-fluoro-4-(methanesulfonamido)-N-(2-methylpiperidin-3-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 120726470 |
| Molecular Formula | C13H20FN3O4S2 |
| Molecular Weight | 365.45 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | 3-fluoro-4-(methanesulfonamido)-N-(2-methylpiperidin-3-yl)benzenesulfonamide |
| SMILES | CC1NCCCC1NS(=O)(=O)c1ccc(NS(C)(=O)=O)c(F)c1 |
| InChI | InChI=1S/C13H20FN3O4S2/c1-9-12(4-3-7-15-9)17-23(20,21)10-5-6-13(11(14)8-10)16-22(2,18)19/h5-6,8-9,12,15-17H,3-4,7H2,1-2H3 |
| InChIKey | JHBVTEYVWDYJTI-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.45 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |