C21H22OS — CID 1207274
4,4,6,6-tetramethyl-2,2-diphenyl-1-thiaspiro[2.3]hexan-5-one (PubChem CID 1207274) has the molecular formula C21H22OS and a molecular weight of 322.47 g/mol. Its IUPAC name is 4,4,6,6-tetramethyl-2,2-diphenyl-1-thiaspiro[2.3]hexan-5-one.
| Compound Name | 4,4,6,6-tetramethyl-2,2-diphenyl-1-thiaspiro[2.3]hexan-5-one |
|---|---|
| PubChem CID | 1207274 |
| Molecular Formula | C21H22OS |
| Molecular Weight | 322.47 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | 4,4,6,6-tetramethyl-2,2-diphenyl-1-thiaspiro[2.3]hexan-5-one |
| SMILES | CC1(C)C(=O)C(C)(C)C12SC2(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H22OS/c1-18(2)17(22)19(3,4)21(18)20(23-21,15-11-7-5-8-12-15)16-13-9-6-10-14-16/h5-14H,1-4H3 |
| InChIKey | NBZITYVPHYPXCT-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.47 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|