C13H20BrCl2N3O — CID 120727576
[3-(2-aminoethyl)piperidin-1-yl]-(5-bromo-2-pyridinyl)methanone;dihydrochloride (PubChem CID 120727576) has the molecular formula C13H20BrCl2N3O and a molecular weight of 385.13 g/mol. Its IUPAC name is [3-(2-aminoethyl)piperidin-1-yl]-(5-bromo-2-pyridinyl)methanone;dihydrochloride.
| Compound Name | [3-(2-aminoethyl)piperidin-1-yl]-(5-bromo-2-pyridinyl)methanone;dihydrochloride |
|---|---|
| PubChem CID | 120727576 |
| Molecular Formula | C13H20BrCl2N3O |
| Molecular Weight | 385.13 g/mol |
| Exact Mass | 383.02 |
| IUPAC Name | [3-(2-aminoethyl)piperidin-1-yl]-(5-bromo-2-pyridinyl)methanone;dihydrochloride |
| SMILES | Cl.Cl.NCCC1CCCN(C(=O)c2ccc(Br)cn2)C1 |
| InChI | InChI=1S/C13H18BrN3O.2ClH/c14-11-3-4-12(16-8-11)13(18)17-7-1-2-10(9-17)5-6-15;;/h3-4,8,10H,1-2,5-7,9,15H2;2*1H |
| InChIKey | VAIRDCJNUWTQTN-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.13 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |