About N'-[2-[(2,4-difluorophenyl)sulfonylamino]ethyl]-4-methylpiperidine-1-carboximidamide
N'-[2-[(2,4-difluorophenyl)sulfonylamino]ethyl]-4-methylpiperidine-1-carboximidamide (PubChem CID 120727815) has the molecular formula C15H22F2N4O2S
and a molecular weight of 360.43 g/mol. Its IUPAC name is N'-[2-[(2,4-difluorophenyl)sulfonylamino]ethyl]-4-methylpiperidine-1-carboximidamide.
Molecular Properties
| Compound Name | N'-[2-[(2,4-difluorophenyl)sulfonylamino]ethyl]-4-methylpiperidine-1-carboximidamide |
| PubChem CID | 120727815 |
| Molecular Formula | C15H22F2N4O2S |
| Molecular Weight | 360.43 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | N'-[2-[(2,4-difluorophenyl)sulfonylamino]ethyl]-4-methylpiperidine-1-carboximidamide |
| SMILES | CC1CCN(/C(N)=N/CCNS(=O)(=O)c2ccc(F)cc2F)CC1 |
| InChI | InChI=1S/C15H22F2N4O2S/c1-11-4-8-21(9-5-11)15(18)19-6-7-20-24(22,23)14-3-2-12(16)10-13(14)17/h2-3,10-11,20H,4-9H2,1H3,(H2,18,19) |
| InChIKey | ULNFOYMJWRFFOX-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 87.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.43 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-[2-[(2,4-difluorophenyl)sulfonylamino]ethyl]-4-methylpiperidine-1-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[2-[(2,4-difluorophenyl)sulfonylamino]ethyl]-4-methylpiperidine-1-carboximidamide?
The IUPAC name of N'-[2-[(2,4-difluorophenyl)sulfonylamino]ethyl]-4-methylpiperidine-1-carboximidamide (CID 120727815) is N'-[2-[(2,4-difluorophenyl)sulfonylamino]ethyl]-4-methylpiperidine-1-carboximidamide.
What is the SMILES notation for N'-[2-[(2,4-difluorophenyl)sulfonylamino]ethyl]-4-methylpiperidine-1-carboximidamide?
The canonical SMILES for N'-[2-[(2,4-difluorophenyl)sulfonylamino]ethyl]-4-methylpiperidine-1-carboximidamide is CC1CCN(/C(N)=N/CCNS(=O)(=O)c2ccc(F)cc2F)CC1.
What is the InChIKey of N'-[2-[(2,4-difluorophenyl)sulfonylamino]ethyl]-4-methylpiperidine-1-carboximidamide?
The InChIKey is ULNFOYMJWRFFOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22F2N4O2S/c1-11-4-8-21(9-5-11)15(18)19-6-7-20-24(22,23)14-3-2-12(16)10-13(14)17/h2-3,10-11,20H,4-9H2,1H3,(H2,18,19).
What are the key properties of N'-[2-[(2,4-difluorophenyl)sulfonylamino]ethyl]-4-methylpiperidine-1-carboximidamide?
N'-[2-[(2,4-difluorophenyl)sulfonylamino]ethyl]-4-methylpiperidine-1-carboximidamide has a molecular weight of 360.43 g/mol, XLogP of 1.29, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[2-[(2,4-difluorophenyl)sulfonylamino]ethyl]-4-methylpiperidine-1-carboximidamide is sourced from PubChem (CID 120727815), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).