C19H26N6O — CID 120727833
1-[[(2R,3S)-2-(1-benzylpyrazol-4-yl)-1-methyl-5-oxopyrrolidin-3-yl]methyl]-2,3-dimethylguanidine (PubChem CID 120727833) has the molecular formula C19H26N6O and a molecular weight of 354.46 g/mol. Its IUPAC name is 1-[[(2R,3S)-2-(1-benzylpyrazol-4-yl)-1-methyl-5-oxopyrrolidin-3-yl]methyl]-2,3-dimethylguanidine.
| Compound Name | 1-[[(2R,3S)-2-(1-benzylpyrazol-4-yl)-1-methyl-5-oxopyrrolidin-3-yl]methyl]-2,3-dimethylguanidine |
|---|---|
| PubChem CID | 120727833 |
| Molecular Formula | C19H26N6O |
| Molecular Weight | 354.46 g/mol |
| Exact Mass | 354.22 |
| IUPAC Name | 1-[[(2R,3S)-2-(1-benzylpyrazol-4-yl)-1-methyl-5-oxopyrrolidin-3-yl]methyl]-2,3-dimethylguanidine |
| SMILES | C/N=C(\NC)NC[C@@H]1CC(=O)N(C)[C@H]1c1cnn(Cc2ccccc2)c1 |
| InChI | InChI=1S/C19H26N6O/c1-20-19(21-2)22-10-15-9-17(26)24(3)18(15)16-11-23-25(13-16)12-14-7-5-4-6-8-14/h4-8,11,13,15,18H,9-10,12H2,1-3H3,(H2,20,21,22)/t15-,18+/m0/s1 |
| InChIKey | CLHVMERWMFVHKQ-MAUKXSAKSA-N |
| XLogP | 1.25 |
| TPSA | 74.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.46 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|