C15H23Cl2FN2 — CID 120728172
2-[1-[1-(3-chloro-4-fluorophenyl)ethyl]piperidin-3-yl]ethanamine;hydrochloride (PubChem CID 120728172) has the molecular formula C15H23Cl2FN2 and a molecular weight of 321.27 g/mol. Its IUPAC name is 2-[1-[1-(3-chloro-4-fluorophenyl)ethyl]piperidin-3-yl]ethanamine;hydrochloride.
| Compound Name | 2-[1-[1-(3-chloro-4-fluorophenyl)ethyl]piperidin-3-yl]ethanamine;hydrochloride |
|---|---|
| PubChem CID | 120728172 |
| Molecular Formula | C15H23Cl2FN2 |
| Molecular Weight | 321.27 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | 2-[1-[1-(3-chloro-4-fluorophenyl)ethyl]piperidin-3-yl]ethanamine;hydrochloride |
| SMILES | CC(c1ccc(F)c(Cl)c1)N1CCCC(CCN)C1.Cl |
| InChI | InChI=1S/C15H22ClFN2.ClH/c1-11(13-4-5-15(17)14(16)9-13)19-8-2-3-12(10-19)6-7-18;/h4-5,9,11-12H,2-3,6-8,10,18H2,1H3;1H |
| InChIKey | IMEMJINFIOENIU-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.27 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |