C36H62O5SSi2 — CID 12072842
methyl 7-[(1R,2R,3R,5S)-2-[3-(1-benzothiophen-2-yl)-3-hydroxypropyl]-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]cyclopentyl]heptanoate (PubChem CID 12072842) has the molecular formula C36H62O5SSi2 and a molecular weight of 663.13 g/mol. Its IUPAC name is methyl 7-[(1R,2R,3R,5S)-2-[3-(1-benzothiophen-2-yl)-3-hydroxypropyl]-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]cyclopentyl]heptanoate.
| Compound Name | methyl 7-[(1R,2R,3R,5S)-2-[3-(1-benzothiophen-2-yl)-3-hydroxypropyl]-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]cyclopentyl]heptanoate |
|---|---|
| PubChem CID | 12072842 |
| Molecular Formula | C36H62O5SSi2 |
| Molecular Weight | 663.13 g/mol |
| Exact Mass | 662.39 |
| IUPAC Name | methyl 7-[(1R,2R,3R,5S)-2-[3-(1-benzothiophen-2-yl)-3-hydroxypropyl]-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]cyclopentyl]heptanoate |
| SMILES | COC(=O)CCCCCC[C@@H]1[C@@H](CCC(O)c2cc3ccccc3s2)[C@H](O[Si](C)(C)C(C)(C)C)C[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C36H62O5SSi2/c1-35(2,3)43(8,9)40-30-25-31(41-44(10,11)36(4,5)6)28(27(30)19-14-12-13-15-21-34(38)39-7)22-23-29(37)33-24-26-18-16-17-20-32(26)42-33/h16-18,20,24,27-31,37H,12-15,19,21-23,25H2,1-11H3/t27-,28-,29?,30+,31-/m1/s1 |
| InChIKey | QMDQGWZRBLSQEJ-YIWIIWOASA-N |
| XLogP | 10.65 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.13 |
| LogP ≤ 5 | 10.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|