About 2-[1-[(2-methyl-1,3-thiazol-4-yl)methyl]piperidin-3-yl]ethanamine;hydrochloride
2-[1-[(2-methyl-1,3-thiazol-4-yl)methyl]piperidin-3-yl]ethanamine;hydrochloride (PubChem CID 120728713) has the molecular formula C12H22ClN3S
and a molecular weight of 275.85 g/mol. Its IUPAC name is 2-[1-[(2-methyl-1,3-thiazol-4-yl)methyl]piperidin-3-yl]ethanamine;hydrochloride.
Molecular Properties
| Compound Name | 2-[1-[(2-methyl-1,3-thiazol-4-yl)methyl]piperidin-3-yl]ethanamine;hydrochloride |
| PubChem CID | 120728713 |
| Molecular Formula | C12H22ClN3S |
| Molecular Weight | 275.85 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | 2-[1-[(2-methyl-1,3-thiazol-4-yl)methyl]piperidin-3-yl]ethanamine;hydrochloride |
| SMILES | Cc1nc(CN2CCCC(CCN)C2)cs1.Cl |
| InChI | InChI=1S/C12H21N3S.ClH/c1-10-14-12(9-16-10)8-15-6-2-3-11(7-15)4-5-13;/h9,11H,2-8,13H2,1H3;1H |
| InChIKey | RRNKXLBKXRQKMN-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.85 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[1-[(2-methyl-1,3-thiazol-4-yl)methyl]piperidin-3-yl]ethanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-[(2-methyl-1,3-thiazol-4-yl)methyl]piperidin-3-yl]ethanamine;hydrochloride?
The IUPAC name of 2-[1-[(2-methyl-1,3-thiazol-4-yl)methyl]piperidin-3-yl]ethanamine;hydrochloride (CID 120728713) is 2-[1-[(2-methyl-1,3-thiazol-4-yl)methyl]piperidin-3-yl]ethanamine;hydrochloride.
What is the SMILES notation for 2-[1-[(2-methyl-1,3-thiazol-4-yl)methyl]piperidin-3-yl]ethanamine;hydrochloride?
The canonical SMILES for 2-[1-[(2-methyl-1,3-thiazol-4-yl)methyl]piperidin-3-yl]ethanamine;hydrochloride is Cc1nc(CN2CCCC(CCN)C2)cs1.Cl.
What is the InChIKey of 2-[1-[(2-methyl-1,3-thiazol-4-yl)methyl]piperidin-3-yl]ethanamine;hydrochloride?
The InChIKey is RRNKXLBKXRQKMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21N3S.ClH/c1-10-14-12(9-16-10)8-15-6-2-3-11(7-15)4-5-13;/h9,11H,2-8,13H2,1H3;1H.
What are the key properties of 2-[1-[(2-methyl-1,3-thiazol-4-yl)methyl]piperidin-3-yl]ethanamine;hydrochloride?
2-[1-[(2-methyl-1,3-thiazol-4-yl)methyl]piperidin-3-yl]ethanamine;hydrochloride has a molecular weight of 275.85 g/mol, XLogP of 2.43, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-[(2-methyl-1,3-thiazol-4-yl)methyl]piperidin-3-yl]ethanamine;hydrochloride is sourced from PubChem (CID 120728713), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).