About 3,4-dimethylbenzoic acid
3,4-dimethylbenzoic acid (PubChem CID 12073) has the molecular formula C9H10O2
and a molecular weight of 150.18 g/mol. Its IUPAC name is 3,4-dimethylbenzoic acid.
Molecular Properties
| Compound Name | 3,4-dimethylbenzoic acid |
| PubChem CID | 12073 |
| Molecular Formula | C9H10O2 |
| Molecular Weight | 150.18 g/mol |
| Exact Mass | 150.07 |
| IUPAC Name | 3,4-dimethylbenzoic acid |
| SMILES | Cc1ccc(C(=O)O)cc1C |
| InChI | InChI=1S/C9H10O2/c1-6-3-4-8(9(10)11)5-7(6)2/h3-5H,1-2H3,(H,10,11) |
| InChIKey | OPVAJFQBSDUNQA-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.18 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3,4-dimethylbenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dimethylbenzoic acid?
The IUPAC name of 3,4-dimethylbenzoic acid (CID 12073) is 3,4-dimethylbenzoic acid.
What is the SMILES notation for 3,4-dimethylbenzoic acid?
The canonical SMILES for 3,4-dimethylbenzoic acid is Cc1ccc(C(=O)O)cc1C.
What is the InChIKey of 3,4-dimethylbenzoic acid?
The InChIKey is OPVAJFQBSDUNQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O2/c1-6-3-4-8(9(10)11)5-7(6)2/h3-5H,1-2H3,(H,10,11).
What are the key properties of 3,4-dimethylbenzoic acid?
3,4-dimethylbenzoic acid has a molecular weight of 150.18 g/mol, XLogP of 2.00, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dimethylbenzoic acid is sourced from PubChem (CID 12073), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).