C22H28N4O — CID 120731808
(1-benzylpiperidin-4-yl)-(2-pyridin-3-ylpiperazin-1-yl)methanone (PubChem CID 120731808) has the molecular formula C22H28N4O and a molecular weight of 364.49 g/mol. Its IUPAC name is (1-benzylpiperidin-4-yl)-(2-pyridin-3-ylpiperazin-1-yl)methanone.
| Compound Name | (1-benzylpiperidin-4-yl)-(2-pyridin-3-ylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 120731808 |
| Molecular Formula | C22H28N4O |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.23 |
| IUPAC Name | (1-benzylpiperidin-4-yl)-(2-pyridin-3-ylpiperazin-1-yl)methanone |
| SMILES | O=C(C1CCN(Cc2ccccc2)CC1)N1CCNCC1c1cccnc1 |
| InChI | InChI=1S/C22H28N4O/c27-22(26-14-11-24-16-21(26)20-7-4-10-23-15-20)19-8-12-25(13-9-19)17-18-5-2-1-3-6-18/h1-7,10,15,19,21,24H,8-9,11-14,16-17H2 |
| InChIKey | BSWSGIWKTLPIIQ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |