C22H23N3O2S — CID 120732761
(2-benzyl-1,3-thiazol-4-yl)-[2-(2-methoxyphenyl)piperazin-1-yl]methanone (PubChem CID 120732761) has the molecular formula C22H23N3O2S and a molecular weight of 393.51 g/mol. Its IUPAC name is (2-benzyl-1,3-thiazol-4-yl)-[2-(2-methoxyphenyl)piperazin-1-yl]methanone.
| Compound Name | (2-benzyl-1,3-thiazol-4-yl)-[2-(2-methoxyphenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 120732761 |
| Molecular Formula | C22H23N3O2S |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | (2-benzyl-1,3-thiazol-4-yl)-[2-(2-methoxyphenyl)piperazin-1-yl]methanone |
| SMILES | COc1ccccc1C1CNCCN1C(=O)c1csc(Cc2ccccc2)n1 |
| InChI | InChI=1S/C22H23N3O2S/c1-27-20-10-6-5-9-17(20)19-14-23-11-12-25(19)22(26)18-15-28-21(24-18)13-16-7-3-2-4-8-16/h2-10,15,19,23H,11-14H2,1H3 |
| InChIKey | BHLWDMCZDNBTSA-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |