C20H24ClN3O4 — CID 120732884
4-[2-[2-(2-methoxyphenyl)piperazin-1-yl]-2-oxoethoxy]benzamide;hydrochloride (PubChem CID 120732884) has the molecular formula C20H24ClN3O4 and a molecular weight of 405.88 g/mol. Its IUPAC name is 4-[2-[2-(2-methoxyphenyl)piperazin-1-yl]-2-oxoethoxy]benzamide;hydrochloride.
| Compound Name | 4-[2-[2-(2-methoxyphenyl)piperazin-1-yl]-2-oxoethoxy]benzamide;hydrochloride |
|---|---|
| PubChem CID | 120732884 |
| Molecular Formula | C20H24ClN3O4 |
| Molecular Weight | 405.88 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | 4-[2-[2-(2-methoxyphenyl)piperazin-1-yl]-2-oxoethoxy]benzamide;hydrochloride |
| SMILES | COc1ccccc1C1CNCCN1C(=O)COc1ccc(C(N)=O)cc1.Cl |
| InChI | InChI=1S/C20H23N3O4.ClH/c1-26-18-5-3-2-4-16(18)17-12-22-10-11-23(17)19(24)13-27-15-8-6-14(7-9-15)20(21)25;/h2-9,17,22H,10-13H2,1H3,(H2,21,25);1H |
| InChIKey | YNNUJJJKDQTJOL-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.88 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |