C18H17F3N2O2 — CID 120733240
[2-(2-methoxyphenyl)piperazin-1-yl]-(3,4,5-trifluorophenyl)methanone (PubChem CID 120733240) has the molecular formula C18H17F3N2O2 and a molecular weight of 350.34 g/mol. Its IUPAC name is [2-(2-methoxyphenyl)piperazin-1-yl]-(3,4,5-trifluorophenyl)methanone.
| Compound Name | [2-(2-methoxyphenyl)piperazin-1-yl]-(3,4,5-trifluorophenyl)methanone |
|---|---|
| PubChem CID | 120733240 |
| Molecular Formula | C18H17F3N2O2 |
| Molecular Weight | 350.34 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | [2-(2-methoxyphenyl)piperazin-1-yl]-(3,4,5-trifluorophenyl)methanone |
| SMILES | COc1ccccc1C1CNCCN1C(=O)c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C18H17F3N2O2/c1-25-16-5-3-2-4-12(16)15-10-22-6-7-23(15)18(24)11-8-13(19)17(21)14(20)9-11/h2-5,8-9,15,22H,6-7,10H2,1H3 |
| InChIKey | ZSLQAUUYJJVOIY-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.34 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|