C13H19N3O3 — CID 12073370
3-[(3aS,4S,7S,7aS)-5,7-dimethyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-4-yl]-1,1-dimethylurea (PubChem CID 12073370) has the molecular formula C13H19N3O3 and a molecular weight of 265.31 g/mol. Its IUPAC name is 3-[(3aS,4S,7S,7aS)-5,7-dimethyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-4-yl]-1,1-dimethylurea.
| Compound Name | 3-[(3aS,4S,7S,7aS)-5,7-dimethyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-4-yl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 12073370 |
| Molecular Formula | C13H19N3O3 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.14 |
| IUPAC Name | 3-[(3aS,4S,7S,7aS)-5,7-dimethyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-4-yl]-1,1-dimethylurea |
| SMILES | CC1=C[C@H](C)[C@@H]2C(=O)NC(=O)[C@@H]2[C@@H]1NC(=O)N(C)C |
| InChI | InChI=1S/C13H19N3O3/c1-6-5-7(2)10(14-13(19)16(3)4)9-8(6)11(17)15-12(9)18/h5-6,8-10H,1-4H3,(H,14,19)(H,15,17,18)/t6-,8-,9-,10+/m0/s1 |
| InChIKey | LFTLUHGULNSBIP-MIBSWOBISA-N |
| XLogP | 0.11 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|