C19H33Cl2N3O2 — CID 120734114
2-(diethylamino)-1-[2-(2-methoxyphenyl)piperazin-1-yl]butan-1-one;dihydrochloride (PubChem CID 120734114) has the molecular formula C19H33Cl2N3O2 and a molecular weight of 406.40 g/mol. Its IUPAC name is 2-(diethylamino)-1-[2-(2-methoxyphenyl)piperazin-1-yl]butan-1-one;dihydrochloride.
| Compound Name | 2-(diethylamino)-1-[2-(2-methoxyphenyl)piperazin-1-yl]butan-1-one;dihydrochloride |
|---|---|
| PubChem CID | 120734114 |
| Molecular Formula | C19H33Cl2N3O2 |
| Molecular Weight | 406.40 g/mol |
| Exact Mass | 405.19 |
| IUPAC Name | 2-(diethylamino)-1-[2-(2-methoxyphenyl)piperazin-1-yl]butan-1-one;dihydrochloride |
| SMILES | CCC(C(=O)N1CCNCC1c1ccccc1OC)N(CC)CC.Cl.Cl |
| InChI | InChI=1S/C19H31N3O2.2ClH/c1-5-16(21(6-2)7-3)19(23)22-13-12-20-14-17(22)15-10-8-9-11-18(15)24-4;;/h8-11,16-17,20H,5-7,12-14H2,1-4H3;2*1H |
| InChIKey | KUZQPRMTVXDFMM-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.40 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |