About bis[2,6-bis(trifluoromethyl)phenyl]-difluorosilane
bis[2,6-bis(trifluoromethyl)phenyl]-difluorosilane (PubChem CID 12073570) has the molecular formula C16H6F14Si
and a molecular weight of 492.28 g/mol. Its IUPAC name is bis[2,6-bis(trifluoromethyl)phenyl]-difluorosilane.
Molecular Properties
| Compound Name | bis[2,6-bis(trifluoromethyl)phenyl]-difluorosilane |
| PubChem CID | 12073570 |
| Molecular Formula | C16H6F14Si |
| Molecular Weight | 492.28 g/mol |
| Exact Mass | 492.00 |
| IUPAC Name | bis[2,6-bis(trifluoromethyl)phenyl]-difluorosilane |
| SMILES | FC(F)(F)c1cccc(C(F)(F)F)c1[Si](F)(F)c1c(C(F)(F)F)cccc1C(F)(F)F |
| InChI | InChI=1S/C16H6F14Si/c17-13(18,19)7-3-1-4-8(14(20,21)22)11(7)31(29,30)12-9(15(23,24)25)5-2-6-10(12)16(26,27)28/h1-6H |
| InChIKey | SHZNSEAJOBYHQA-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 492.28 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze bis[2,6-bis(trifluoromethyl)phenyl]-difluorosilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[2,6-bis(trifluoromethyl)phenyl]-difluorosilane?
The IUPAC name of bis[2,6-bis(trifluoromethyl)phenyl]-difluorosilane (CID 12073570) is bis[2,6-bis(trifluoromethyl)phenyl]-difluorosilane.
What is the SMILES notation for bis[2,6-bis(trifluoromethyl)phenyl]-difluorosilane?
The canonical SMILES for bis[2,6-bis(trifluoromethyl)phenyl]-difluorosilane is FC(F)(F)c1cccc(C(F)(F)F)c1[Si](F)(F)c1c(C(F)(F)F)cccc1C(F)(F)F.
What is the InChIKey of bis[2,6-bis(trifluoromethyl)phenyl]-difluorosilane?
The InChIKey is SHZNSEAJOBYHQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H6F14Si/c17-13(18,19)7-3-1-4-8(14(20,21)22)11(7)31(29,30)12-9(15(23,24)25)5-2-6-10(12)16(26,27)28/h1-6H.
What are the key properties of bis[2,6-bis(trifluoromethyl)phenyl]-difluorosilane?
bis[2,6-bis(trifluoromethyl)phenyl]-difluorosilane has a molecular weight of 492.28 g/mol, XLogP of 6.26, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for bis[2,6-bis(trifluoromethyl)phenyl]-difluorosilane is sourced from PubChem (CID 12073570), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).