C17H26ClFN2OS — CID 120735966
2-butylsulfanyl-1-[2-(3-fluorophenyl)piperazin-1-yl]propan-1-one;hydrochloride (PubChem CID 120735966) has the molecular formula C17H26ClFN2OS and a molecular weight of 360.93 g/mol. Its IUPAC name is 2-butylsulfanyl-1-[2-(3-fluorophenyl)piperazin-1-yl]propan-1-one;hydrochloride.
| Compound Name | 2-butylsulfanyl-1-[2-(3-fluorophenyl)piperazin-1-yl]propan-1-one;hydrochloride |
|---|---|
| PubChem CID | 120735966 |
| Molecular Formula | C17H26ClFN2OS |
| Molecular Weight | 360.93 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | 2-butylsulfanyl-1-[2-(3-fluorophenyl)piperazin-1-yl]propan-1-one;hydrochloride |
| SMILES | CCCCSC(C)C(=O)N1CCNCC1c1cccc(F)c1.Cl |
| InChI | InChI=1S/C17H25FN2OS.ClH/c1-3-4-10-22-13(2)17(21)20-9-8-19-12-16(20)14-6-5-7-15(18)11-14;/h5-7,11,13,16,19H,3-4,8-10,12H2,1-2H3;1H |
| InChIKey | IOQQNHYVVPRGOH-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.93 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|