C24H29FO3Si — CID 12073620
(3aR,4S,5S,6aS)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-fluoro-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one (PubChem CID 12073620) has the molecular formula C24H29FO3Si and a molecular weight of 412.58 g/mol. Its IUPAC name is (3aR,4S,5S,6aS)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-fluoro-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one.
| Compound Name | (3aR,4S,5S,6aS)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-fluoro-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
|---|---|
| PubChem CID | 12073620 |
| Molecular Formula | C24H29FO3Si |
| Molecular Weight | 412.58 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | (3aR,4S,5S,6aS)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-fluoro-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
| SMILES | CC(C)(C)[Si](OC[C@@H]1[C@H]2CC(=O)O[C@H]2C[C@@H]1F)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H29FO3Si/c1-24(2,3)29(17-10-6-4-7-11-17,18-12-8-5-9-13-18)27-16-20-19-14-23(26)28-22(19)15-21(20)25/h4-13,19-22H,14-16H2,1-3H3/t19-,20-,21+,22+/m1/s1 |
| InChIKey | ICMDJQNVBUZZGZ-CZYKHXBRSA-N |
| XLogP | 3.85 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.58 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|