C32H45FO4Si — CID 12073622
propan-2-yl (E)-7-[(1R,2S,3S,5S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-fluoro-5-hydroxycyclopentyl]hept-5-enoate (PubChem CID 12073622) has the molecular formula C32H45FO4Si and a molecular weight of 540.79 g/mol. Its IUPAC name is propan-2-yl (E)-7-[(1R,2S,3S,5S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-fluoro-5-hydroxycyclopentyl]hept-5-enoate.
| Compound Name | propan-2-yl (E)-7-[(1R,2S,3S,5S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-fluoro-5-hydroxycyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 12073622 |
| Molecular Formula | C32H45FO4Si |
| Molecular Weight | 540.79 g/mol |
| Exact Mass | 540.31 |
| IUPAC Name | propan-2-yl (E)-7-[(1R,2S,3S,5S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-fluoro-5-hydroxycyclopentyl]hept-5-enoate |
| SMILES | CC(C)OC(=O)CCC/C=C/C[C@@H]1[C@@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@@H](F)C[C@@H]1O |
| InChI | InChI=1S/C32H45FO4Si/c1-24(2)37-31(35)21-15-7-6-14-20-27-28(29(33)22-30(27)34)23-36-38(32(3,4)5,25-16-10-8-11-17-25)26-18-12-9-13-19-26/h6,8-14,16-19,24,27-30,34H,7,15,20-23H2,1-5H3/b14-6+/t27-,28-,29+,30+/m1/s1 |
| InChIKey | FNRZBNJXOUIZBU-NAVGJFQVSA-N |
| XLogP | 5.97 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.79 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|