C24H12N4O4 — CID 12073701
6,13-dipyridin-3-yl-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone (PubChem CID 12073701) has the molecular formula C24H12N4O4 and a molecular weight of 420.38 g/mol. Its IUPAC name is 6,13-dipyridin-3-yl-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone.
| Compound Name | 6,13-dipyridin-3-yl-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone |
|---|---|
| PubChem CID | 12073701 |
| Molecular Formula | C24H12N4O4 |
| Molecular Weight | 420.38 g/mol |
| Exact Mass | 420.09 |
| IUPAC Name | 6,13-dipyridin-3-yl-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone |
| SMILES | O=C1c2ccc3c4c(ccc(c24)C(=O)N1c1cccnc1)C(=O)N(c1cccnc1)C3=O |
| InChI | InChI=1S/C24H12N4O4/c29-21-15-5-7-17-20-18(24(32)28(23(17)31)14-4-2-10-26-12-14)8-6-16(19(15)20)22(30)27(21)13-3-1-9-25-11-13/h1-12H |
| InChIKey | IMJOVHKTYLXLEC-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 100.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.38 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|