C22H26ClN3O2 — CID 120738630
4-[2-(2-chlorophenyl)piperazine-1-carbonyl]-N,N-diethylbenzamide (PubChem CID 120738630) has the molecular formula C22H26ClN3O2 and a molecular weight of 399.92 g/mol. Its IUPAC name is 4-[2-(2-chlorophenyl)piperazine-1-carbonyl]-N,N-diethylbenzamide.
| Compound Name | 4-[2-(2-chlorophenyl)piperazine-1-carbonyl]-N,N-diethylbenzamide |
|---|---|
| PubChem CID | 120738630 |
| Molecular Formula | C22H26ClN3O2 |
| Molecular Weight | 399.92 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | 4-[2-(2-chlorophenyl)piperazine-1-carbonyl]-N,N-diethylbenzamide |
| SMILES | CCN(CC)C(=O)c1ccc(C(=O)N2CCNCC2c2ccccc2Cl)cc1 |
| InChI | InChI=1S/C22H26ClN3O2/c1-3-25(4-2)21(27)16-9-11-17(12-10-16)22(28)26-14-13-24-15-20(26)18-7-5-6-8-19(18)23/h5-12,20,24H,3-4,13-15H2,1-2H3 |
| InChIKey | PCQXDPOQZZYDMZ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.92 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |