C19H21Cl2N3O2 — CID 120739011
N-[2-[2-(2-chlorophenyl)piperazin-1-yl]-2-oxoethyl]benzamide;hydrochloride (PubChem CID 120739011) has the molecular formula C19H21Cl2N3O2 and a molecular weight of 394.30 g/mol. Its IUPAC name is N-[2-[2-(2-chlorophenyl)piperazin-1-yl]-2-oxoethyl]benzamide;hydrochloride.
| Compound Name | N-[2-[2-(2-chlorophenyl)piperazin-1-yl]-2-oxoethyl]benzamide;hydrochloride |
|---|---|
| PubChem CID | 120739011 |
| Molecular Formula | C19H21Cl2N3O2 |
| Molecular Weight | 394.30 g/mol |
| Exact Mass | 393.10 |
| IUPAC Name | N-[2-[2-(2-chlorophenyl)piperazin-1-yl]-2-oxoethyl]benzamide;hydrochloride |
| SMILES | Cl.O=C(NCC(=O)N1CCNCC1c1ccccc1Cl)c1ccccc1 |
| InChI | InChI=1S/C19H20ClN3O2.ClH/c20-16-9-5-4-8-15(16)17-12-21-10-11-23(17)18(24)13-22-19(25)14-6-2-1-3-7-14;/h1-9,17,21H,10-13H2,(H,22,25);1H |
| InChIKey | SBQSBUHZIKNRMB-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.30 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |