C19H25N3O4S — CID 120740627
N-[[5-[2-(4-ethylphenyl)piperazine-1-carbonyl]furan-2-yl]methyl]methanesulfonamide (PubChem CID 120740627) has the molecular formula C19H25N3O4S and a molecular weight of 391.49 g/mol. Its IUPAC name is N-[[5-[2-(4-ethylphenyl)piperazine-1-carbonyl]furan-2-yl]methyl]methanesulfonamide.
| Compound Name | N-[[5-[2-(4-ethylphenyl)piperazine-1-carbonyl]furan-2-yl]methyl]methanesulfonamide |
|---|---|
| PubChem CID | 120740627 |
| Molecular Formula | C19H25N3O4S |
| Molecular Weight | 391.49 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | N-[[5-[2-(4-ethylphenyl)piperazine-1-carbonyl]furan-2-yl]methyl]methanesulfonamide |
| SMILES | CCc1ccc(C2CNCCN2C(=O)c2ccc(CNS(C)(=O)=O)o2)cc1 |
| InChI | InChI=1S/C19H25N3O4S/c1-3-14-4-6-15(7-5-14)17-13-20-10-11-22(17)19(23)18-9-8-16(26-18)12-21-27(2,24)25/h4-9,17,20-21H,3,10-13H2,1-2H3 |
| InChIKey | GSYJEQUEPXZKDL-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.49 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |