C23H30N2O3 — CID 120741469
3-(3,4-dimethoxyphenyl)-1-[2-(4-ethylphenyl)piperazin-1-yl]propan-1-one (PubChem CID 120741469) has the molecular formula C23H30N2O3 and a molecular weight of 382.50 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-1-[2-(4-ethylphenyl)piperazin-1-yl]propan-1-one.
| Compound Name | 3-(3,4-dimethoxyphenyl)-1-[2-(4-ethylphenyl)piperazin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 120741469 |
| Molecular Formula | C23H30N2O3 |
| Molecular Weight | 382.50 g/mol |
| Exact Mass | 382.23 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-1-[2-(4-ethylphenyl)piperazin-1-yl]propan-1-one |
| SMILES | CCc1ccc(C2CNCCN2C(=O)CCc2ccc(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C23H30N2O3/c1-4-17-5-9-19(10-6-17)20-16-24-13-14-25(20)23(26)12-8-18-7-11-21(27-2)22(15-18)28-3/h5-7,9-11,15,20,24H,4,8,12-14,16H2,1-3H3 |
| InChIKey | BQENRQWUSIOERG-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.50 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |