C20H25ClN4O2 — CID 120741592
5-[2-(4-ethylphenyl)piperazine-1-carbonyl]-N-methylpyridine-2-carboxamide;hydrochloride (PubChem CID 120741592) has the molecular formula C20H25ClN4O2 and a molecular weight of 388.90 g/mol. Its IUPAC name is 5-[2-(4-ethylphenyl)piperazine-1-carbonyl]-N-methylpyridine-2-carboxamide;hydrochloride.
| Compound Name | 5-[2-(4-ethylphenyl)piperazine-1-carbonyl]-N-methylpyridine-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 120741592 |
| Molecular Formula | C20H25ClN4O2 |
| Molecular Weight | 388.90 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | 5-[2-(4-ethylphenyl)piperazine-1-carbonyl]-N-methylpyridine-2-carboxamide;hydrochloride |
| SMILES | CCc1ccc(C2CNCCN2C(=O)c2ccc(C(=O)NC)nc2)cc1.Cl |
| InChI | InChI=1S/C20H24N4O2.ClH/c1-3-14-4-6-15(7-5-14)18-13-22-10-11-24(18)20(26)16-8-9-17(23-12-16)19(25)21-2;/h4-9,12,18,22H,3,10-11,13H2,1-2H3,(H,21,25);1H |
| InChIKey | QZPWSRBOZLFIEA-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.90 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |