About 2-[(Z)-3H-1,3-benzoxazol-2-ylidenemethyl]-1,3-benzoxazole
2-[(Z)-3H-1,3-benzoxazol-2-ylidenemethyl]-1,3-benzoxazole (PubChem CID 12074272) has the molecular formula C15H10N2O2
and a molecular weight of 250.26 g/mol. Its IUPAC name is 2-[(Z)-3H-1,3-benzoxazol-2-ylidenemethyl]-1,3-benzoxazole.
Molecular Properties
| Compound Name | 2-[(Z)-3H-1,3-benzoxazol-2-ylidenemethyl]-1,3-benzoxazole |
| PubChem CID | 12074272 |
| Molecular Formula | C15H10N2O2 |
| Molecular Weight | 250.26 g/mol |
| Exact Mass | 250.07 |
| IUPAC Name | 2-[(Z)-3H-1,3-benzoxazol-2-ylidenemethyl]-1,3-benzoxazole |
| SMILES | C(=C1/Nc2ccccc2O1)\c1nc2ccccc2o1 |
| InChI | InChI=1S/C15H10N2O2/c1-3-7-12-10(5-1)16-14(18-12)9-15-17-11-6-2-4-8-13(11)19-15/h1-9,16H/b14-9- |
| InChIKey | XXJFOKYKFDXZST-ZROIWOOFSA-N |
| XLogP | 3.63 |
| TPSA | 47.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.26 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(Z)-3H-1,3-benzoxazol-2-ylidenemethyl]-1,3-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(Z)-3H-1,3-benzoxazol-2-ylidenemethyl]-1,3-benzoxazole?
The IUPAC name of 2-[(Z)-3H-1,3-benzoxazol-2-ylidenemethyl]-1,3-benzoxazole (CID 12074272) is 2-[(Z)-3H-1,3-benzoxazol-2-ylidenemethyl]-1,3-benzoxazole.
What is the SMILES notation for 2-[(Z)-3H-1,3-benzoxazol-2-ylidenemethyl]-1,3-benzoxazole?
The canonical SMILES for 2-[(Z)-3H-1,3-benzoxazol-2-ylidenemethyl]-1,3-benzoxazole is C(=C1/Nc2ccccc2O1)\c1nc2ccccc2o1.
What is the InChIKey of 2-[(Z)-3H-1,3-benzoxazol-2-ylidenemethyl]-1,3-benzoxazole?
The InChIKey is XXJFOKYKFDXZST-ZROIWOOFSA-N. The full InChI is InChI=1S/C15H10N2O2/c1-3-7-12-10(5-1)16-14(18-12)9-15-17-11-6-2-4-8-13(11)19-15/h1-9,16H/b14-9-.
What are the key properties of 2-[(Z)-3H-1,3-benzoxazol-2-ylidenemethyl]-1,3-benzoxazole?
2-[(Z)-3H-1,3-benzoxazol-2-ylidenemethyl]-1,3-benzoxazole has a molecular weight of 250.26 g/mol, XLogP of 3.63, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(Z)-3H-1,3-benzoxazol-2-ylidenemethyl]-1,3-benzoxazole is sourced from PubChem (CID 12074272), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).